About methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate
methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate (PubChem CID 123198908) has the molecular formula C23H31N3O2
and a molecular weight of 381.52 g/mol. Its IUPAC name is methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate |
| PubChem CID | 123198908 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate |
| SMILES | CCc1ccc(-c2cccc(N3CCC(NCC(=O)OC)CC3)n2)cc1CC |
| InChI | InChI=1S/C23H31N3O2/c1-4-17-9-10-19(15-18(17)5-2)21-7-6-8-22(25-21)26-13-11-20(12-14-26)24-16-23(27)28-3/h6-10,15,20,24H,4-5,11-14,16H2,1-3H3 |
| InChIKey | KXDJBGXZRLIBEK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate?
The IUPAC name of methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate (CID 123198908) is methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate.
What is the SMILES notation for methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate?
The canonical SMILES for methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate is CCc1ccc(-c2cccc(N3CCC(NCC(=O)OC)CC3)n2)cc1CC.
What is the InChIKey of methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate?
The InChIKey is KXDJBGXZRLIBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O2/c1-4-17-9-10-19(15-18(17)5-2)21-7-6-8-22(25-21)26-13-11-20(12-14-26)24-16-23(27)28-3/h6-10,15,20,24H,4-5,11-14,16H2,1-3H3.
What are the key properties of methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate?
methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate has a molecular weight of 381.52 g/mol, XLogP of 3.60, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-[6-(3,4-diethylphenyl)-2-pyridinyl]piperidin-4-yl]amino]acetate is sourced from PubChem (CID 123198908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).