C27H41N3O — CID 123362820
3-[[1-[6-[3-ethyl-4-(2-methylhexan-2-yl)phenyl]-2-pyridinyl]pyrrolidin-3-yl]amino]propan-1-ol (PubChem CID 123362820) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is 3-[[1-[6-[3-ethyl-4-(2-methylhexan-2-yl)phenyl]-2-pyridinyl]pyrrolidin-3-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-[6-[3-ethyl-4-(2-methylhexan-2-yl)phenyl]-2-pyridinyl]pyrrolidin-3-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 123362820 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 3-[[1-[6-[3-ethyl-4-(2-methylhexan-2-yl)phenyl]-2-pyridinyl]pyrrolidin-3-yl]amino]propan-1-ol |
| SMILES | CCCCC(C)(C)c1ccc(-c2cccc(N3CCC(NCCCO)C3)n2)cc1CC |
| InChI | InChI=1S/C27H41N3O/c1-5-7-15-27(3,4)24-13-12-22(19-21(24)6-2)25-10-8-11-26(29-25)30-17-14-23(20-30)28-16-9-18-31/h8,10-13,19,23,28,31H,5-7,9,14-18,20H2,1-4H3 |
| InChIKey | JKKLQCHMVTVMKF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|