C28H41N3O — CID 123835102
4-[[1-[6-(5,6,9,9-tetramethyl-5,6,7,8-tetrahydrobenzo[7]annulen-2-yl)-2-pyridinyl]pyrrolidin-3-yl]amino]butan-1-ol (PubChem CID 123835102) has the molecular formula C28H41N3O and a molecular weight of 435.66 g/mol. Its IUPAC name is 4-[[1-[6-(5,6,9,9-tetramethyl-5,6,7,8-tetrahydrobenzo[7]annulen-2-yl)-2-pyridinyl]pyrrolidin-3-yl]amino]butan-1-ol.
| Compound Name | 4-[[1-[6-(5,6,9,9-tetramethyl-5,6,7,8-tetrahydrobenzo[7]annulen-2-yl)-2-pyridinyl]pyrrolidin-3-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 123835102 |
| Molecular Formula | C28H41N3O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 4-[[1-[6-(5,6,9,9-tetramethyl-5,6,7,8-tetrahydrobenzo[7]annulen-2-yl)-2-pyridinyl]pyrrolidin-3-yl]amino]butan-1-ol |
| SMILES | CC1CCC(C)(C)c2cc(-c3cccc(N4CCC(NCCCCO)C4)n3)ccc2C1C |
| InChI | InChI=1S/C28H41N3O/c1-20-12-14-28(3,4)25-18-22(10-11-24(25)21(20)2)26-8-7-9-27(30-26)31-16-13-23(19-31)29-15-5-6-17-32/h7-11,18,20-21,23,29,32H,5-6,12-17,19H2,1-4H3 |
| InChIKey | MUXBJLWQVNGREE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|