C29H44N4O — CID 123656325
2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexan-1-ol (PubChem CID 123656325) has the molecular formula C29H44N4O and a molecular weight of 464.70 g/mol. Its IUPAC name is 2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexan-1-ol.
| Compound Name | 2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 123656325 |
| Molecular Formula | C29H44N4O |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | 2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(CCCCC(N)CO)CC4)n3)ccc21 |
| InChI | InChI=1S/C29H44N4O/c1-28(2)13-14-29(3,4)25-20-22(11-12-24(25)28)26-9-7-10-27(31-26)33-18-16-32(17-19-33)15-6-5-8-23(30)21-34/h7,9-12,20,23,34H,5-6,8,13-19,21,30H2,1-4H3 |
| InChIKey | IFWMZQIDQGHZJT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|