C29H43N3 — CID 123991296
1-pentyl-4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-1,4-diazepane (PubChem CID 123991296) has the molecular formula C29H43N3 and a molecular weight of 433.68 g/mol. Its IUPAC name is 1-pentyl-4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-1,4-diazepane.
| Compound Name | 1-pentyl-4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 123991296 |
| Molecular Formula | C29H43N3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.35 |
| IUPAC Name | 1-pentyl-4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-1,4-diazepane |
| SMILES | CCCCCN1CCCN(c2cccc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)n2)CC1 |
| InChI | InChI=1S/C29H43N3/c1-6-7-8-17-31-18-10-19-32(21-20-31)27-12-9-11-26(30-27)23-13-14-24-25(22-23)29(4,5)16-15-28(24,2)3/h9,11-14,22H,6-8,10,15-21H2,1-5H3 |
| InChIKey | UVRSFCZDYUEBEA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|