C26H37N3O — CID 53250708
4-[4-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-pyridinyl]piperazin-1-yl]butan-1-ol (PubChem CID 53250708) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[4-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-pyridinyl]piperazin-1-yl]butan-1-ol.
| Compound Name | 4-[4-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-pyridinyl]piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 53250708 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 4-[4-[6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-pyridinyl]piperazin-1-yl]butan-1-ol |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3cccc(N4CCN(CCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C26H37N3O/c1-25(2)19-26(3,4)22-18-20(10-11-21(22)25)23-8-7-9-24(27-23)29-15-13-28(14-16-29)12-5-6-17-30/h7-11,18,30H,5-6,12-17,19H2,1-4H3 |
| InChIKey | UVNSTUQHUUKLHB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|