C18H22ClN5O2 — CID 70207493
methyl 2-[[1-[6-(3-chloroanilino)pyrimidin-4-yl]piperidin-4-yl]amino]acetate (PubChem CID 70207493) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is methyl 2-[[1-[6-(3-chloroanilino)pyrimidin-4-yl]piperidin-4-yl]amino]acetate.
| Compound Name | methyl 2-[[1-[6-(3-chloroanilino)pyrimidin-4-yl]piperidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 70207493 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 2-[[1-[6-(3-chloroanilino)pyrimidin-4-yl]piperidin-4-yl]amino]acetate |
| SMILES | COC(=O)CNC1CCN(c2cc(Nc3cccc(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-26-18(25)11-20-14-5-7-24(8-6-14)17-10-16(21-12-22-17)23-15-4-2-3-13(19)9-15/h2-4,9-10,12,14,20H,5-8,11H2,1H3,(H,21,22,23) |
| InChIKey | KOHMCFQXKAROEJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |