C26H33FN4O3 — CID 123200666
1-[4-[3-(2-aminopyrrolidin-1-yl)propoxy]-2-fluorophenyl]-2-(4-benzoylpiperazin-1-yl)ethanone (PubChem CID 123200666) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is 1-[4-[3-(2-aminopyrrolidin-1-yl)propoxy]-2-fluorophenyl]-2-(4-benzoylpiperazin-1-yl)ethanone.
| Compound Name | 1-[4-[3-(2-aminopyrrolidin-1-yl)propoxy]-2-fluorophenyl]-2-(4-benzoylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 123200666 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-[4-[3-(2-aminopyrrolidin-1-yl)propoxy]-2-fluorophenyl]-2-(4-benzoylpiperazin-1-yl)ethanone |
| SMILES | NC1CCCN1CCCOc1ccc(C(=O)CN2CCN(C(=O)c3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H33FN4O3/c27-23-18-21(34-17-5-12-30-11-4-8-25(30)28)9-10-22(23)24(32)19-29-13-15-31(16-14-29)26(33)20-6-2-1-3-7-20/h1-3,6-7,9-10,18,25H,4-5,8,11-17,19,28H2 |
| InChIKey | RAFDYTQMUCUUKP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|