C29H40FN3O3 — CID 123231793
1-[4-[2-[2-fluoro-4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazin-1-yl]-2-prop-1-en-2-ylhexa-2,4-dien-1-one (PubChem CID 123231793) has the molecular formula C29H40FN3O3 and a molecular weight of 497.66 g/mol. Its IUPAC name is 1-[4-[2-[2-fluoro-4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazin-1-yl]-2-prop-1-en-2-ylhexa-2,4-dien-1-one.
| Compound Name | 1-[4-[2-[2-fluoro-4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazin-1-yl]-2-prop-1-en-2-ylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 123231793 |
| Molecular Formula | C29H40FN3O3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 1-[4-[2-[2-fluoro-4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazin-1-yl]-2-prop-1-en-2-ylhexa-2,4-dien-1-one |
| SMILES | C=C(C)C(=CC=CC)C(=O)N1CCN(CC(=O)c2ccc(OCCCN3CCCC3C)cc2F)CC1 |
| InChI | InChI=1S/C29H40FN3O3/c1-5-6-10-25(22(2)3)29(35)33-17-15-31(16-18-33)21-28(34)26-12-11-24(20-27(26)30)36-19-8-14-32-13-7-9-23(32)4/h5-6,10-12,20,23H,2,7-9,13-19,21H2,1,3-4H3 |
| InChIKey | KGWHMMNHPCZGPU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|