C26H32N4O2 — CID 59250207
2-(4-benzoylpiperazin-1-yl)-5-(3-piperidin-1-ylpropoxy)benzonitrile (PubChem CID 59250207) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)-5-(3-piperidin-1-ylpropoxy)benzonitrile.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)-5-(3-piperidin-1-ylpropoxy)benzonitrile |
|---|---|
| PubChem CID | 59250207 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)-5-(3-piperidin-1-ylpropoxy)benzonitrile |
| SMILES | N#Cc1cc(OCCCN2CCCCC2)ccc1N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O2/c27-21-23-20-24(32-19-7-14-28-12-5-2-6-13-28)10-11-25(23)29-15-17-30(18-16-29)26(31)22-8-3-1-4-9-22/h1,3-4,8-11,20H,2,5-7,12-19H2 |
| InChIKey | TYPQGQIJQXESNO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|