C29H28N2O5 — CID 123200814
ethyl 2-[4-[[4-[2-(4-cyanophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate (PubChem CID 123200814) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl 2-[4-[[4-[2-(4-cyanophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[4-[[4-[2-(4-cyanophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123200814 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | ethyl 2-[4-[[4-[2-(4-cyanophenyl)-2-methoxyiminoethoxy]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1c1ccc(OCc2ccc(OCC(=NOC)c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O5/c1-3-34-29(32)27-16-26(27)22-10-14-25(15-11-22)35-18-21-6-12-24(13-7-21)36-19-28(31-33-2)23-8-4-20(17-30)5-9-23/h4-15,26-27H,3,16,18-19H2,1-2H3 |
| InChIKey | LZHYKWHIAAXTRR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|