C22H22Cl2N2O2S — CID 123201108
ethyl 4-chloro-2-(4-chlorophenyl)thieno[2,3-d]pyridazine-7-carboxylate;methylidenecyclohexane (PubChem CID 123201108) has the molecular formula C22H22Cl2N2O2S and a molecular weight of 449.40 g/mol. Its IUPAC name is ethyl 4-chloro-2-(4-chlorophenyl)thieno[2,3-d]pyridazine-7-carboxylate;methylidenecyclohexane.
| Compound Name | ethyl 4-chloro-2-(4-chlorophenyl)thieno[2,3-d]pyridazine-7-carboxylate;methylidenecyclohexane |
|---|---|
| PubChem CID | 123201108 |
| Molecular Formula | C22H22Cl2N2O2S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | ethyl 4-chloro-2-(4-chlorophenyl)thieno[2,3-d]pyridazine-7-carboxylate;methylidenecyclohexane |
| SMILES | C=C1CCCCC1.CCOC(=O)c1nnc(Cl)c2cc(-c3ccc(Cl)cc3)sc12 |
| InChI | InChI=1S/C15H10Cl2N2O2S.C7H12/c1-2-21-15(20)12-13-10(14(17)19-18-12)7-11(22-13)8-3-5-9(16)6-4-8;1-7-5-3-2-4-6-7/h3-7H,2H2,1H3;1-6H2 |
| InChIKey | HZLQCWOHGRSOKO-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|