C16H22ClNO2 — CID 123201143
4-chloro-1-hexyl-5-phenyl-2H-pyrrole-2,5-diol (PubChem CID 123201143) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 4-chloro-1-hexyl-5-phenyl-2H-pyrrole-2,5-diol.
| Compound Name | 4-chloro-1-hexyl-5-phenyl-2H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123201143 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-chloro-1-hexyl-5-phenyl-2H-pyrrole-2,5-diol |
| SMILES | CCCCCCN1C(O)C=C(Cl)C1(O)c1ccccc1 |
| InChI | InChI=1S/C16H22ClNO2/c1-2-3-4-8-11-18-15(19)12-14(17)16(18,20)13-9-6-5-7-10-13/h5-7,9-10,12,15,19-20H,2-4,8,11H2,1H3 |
| InChIKey | QTJNBDMKYAELDK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|