About O-silyl cyclopropanecarbothioate
O-silyl cyclopropanecarbothioate (PubChem CID 123202492) has the molecular formula C4H8OSSi
and a molecular weight of 132.26 g/mol. Its IUPAC name is O-silyl cyclopropanecarbothioate.
Molecular Properties
| Compound Name | O-silyl cyclopropanecarbothioate |
| PubChem CID | 123202492 |
| Molecular Formula | C4H8OSSi |
| Molecular Weight | 132.26 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | O-silyl cyclopropanecarbothioate |
| SMILES | [SiH3]OC(=S)C1CC1 |
| InChI | InChI=1S/C4H8OSSi/c6-4(5-7)3-1-2-3/h3H,1-2H2,7H3 |
| InChIKey | XTGFSXHWAVMUFS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-silyl cyclopropanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-silyl cyclopropanecarbothioate?
The IUPAC name of O-silyl cyclopropanecarbothioate (CID 123202492) is O-silyl cyclopropanecarbothioate.
What is the SMILES notation for O-silyl cyclopropanecarbothioate?
The canonical SMILES for O-silyl cyclopropanecarbothioate is [SiH3]OC(=S)C1CC1.
What is the InChIKey of O-silyl cyclopropanecarbothioate?
The InChIKey is XTGFSXHWAVMUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OSSi/c6-4(5-7)3-1-2-3/h3H,1-2H2,7H3.
What are the key properties of O-silyl cyclopropanecarbothioate?
O-silyl cyclopropanecarbothioate has a molecular weight of 132.26 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-silyl cyclopropanecarbothioate is sourced from PubChem (CID 123202492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).