About O-silyl cyclohexanecarbothioate
O-silyl cyclohexanecarbothioate (PubChem CID 123833034) has the molecular formula C7H14OSSi
and a molecular weight of 174.34 g/mol. Its IUPAC name is O-silyl cyclohexanecarbothioate.
Molecular Properties
| Compound Name | O-silyl cyclohexanecarbothioate |
| PubChem CID | 123833034 |
| Molecular Formula | C7H14OSSi |
| Molecular Weight | 174.34 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | O-silyl cyclohexanecarbothioate |
| SMILES | [SiH3]OC(=S)C1CCCCC1 |
| InChI | InChI=1S/C7H14OSSi/c9-7(8-10)6-4-2-1-3-5-6/h6H,1-5H2,10H3 |
| InChIKey | IUTJWLIYQBCQGS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-silyl cyclohexanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-silyl cyclohexanecarbothioate?
The IUPAC name of O-silyl cyclohexanecarbothioate (CID 123833034) is O-silyl cyclohexanecarbothioate.
What is the SMILES notation for O-silyl cyclohexanecarbothioate?
The canonical SMILES for O-silyl cyclohexanecarbothioate is [SiH3]OC(=S)C1CCCCC1.
What is the InChIKey of O-silyl cyclohexanecarbothioate?
The InChIKey is IUTJWLIYQBCQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OSSi/c9-7(8-10)6-4-2-1-3-5-6/h6H,1-5H2,10H3.
What are the key properties of O-silyl cyclohexanecarbothioate?
O-silyl cyclohexanecarbothioate has a molecular weight of 174.34 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-silyl cyclohexanecarbothioate is sourced from PubChem (CID 123833034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).