About silylmethyl cyclohexanecarbodithioate
silylmethyl cyclohexanecarbodithioate (PubChem CID 164971874) has the molecular formula C8H16S2Si
and a molecular weight of 204.44 g/mol. Its IUPAC name is silylmethyl cyclohexanecarbodithioate.
Molecular Properties
| Compound Name | silylmethyl cyclohexanecarbodithioate |
| PubChem CID | 164971874 |
| Molecular Formula | C8H16S2Si |
| Molecular Weight | 204.44 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | silylmethyl cyclohexanecarbodithioate |
| SMILES | [SiH3]CSC(=S)C1CCCCC1 |
| InChI | InChI=1S/C8H16S2Si/c9-8(10-6-11)7-4-2-1-3-5-7/h7H,1-6H2,11H3 |
| InChIKey | MTJORKCKTFDARG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze silylmethyl cyclohexanecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silylmethyl cyclohexanecarbodithioate?
The IUPAC name of silylmethyl cyclohexanecarbodithioate (CID 164971874) is silylmethyl cyclohexanecarbodithioate.
What is the SMILES notation for silylmethyl cyclohexanecarbodithioate?
The canonical SMILES for silylmethyl cyclohexanecarbodithioate is [SiH3]CSC(=S)C1CCCCC1.
What is the InChIKey of silylmethyl cyclohexanecarbodithioate?
The InChIKey is MTJORKCKTFDARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S2Si/c9-8(10-6-11)7-4-2-1-3-5-7/h7H,1-6H2,11H3.
What are the key properties of silylmethyl cyclohexanecarbodithioate?
silylmethyl cyclohexanecarbodithioate has a molecular weight of 204.44 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silylmethyl cyclohexanecarbodithioate is sourced from PubChem (CID 164971874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).