C20H36BrP — CID 160745709
1,2,2-tricyclohexylethenylphosphanium bromide (PubChem CID 160745709) has the molecular formula C20H36BrP and a molecular weight of 387.39 g/mol. Its IUPAC name is 1,2,2-tricyclohexylethenylphosphanium bromide.
| Compound Name | 1,2,2-tricyclohexylethenylphosphanium bromide |
|---|---|
| PubChem CID | 160745709 |
| Molecular Formula | C20H36BrP |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1,2,2-tricyclohexylethenylphosphanium bromide |
| SMILES | [Br-].[PH3+]C(=C(C1CCCCC1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H35P.BrH/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17;/h16-18H,1-15,21H2;1H |
| InChIKey | RWDYXGRHQKQWMF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|