About S-(2-sulfanylethyl) cyclohexanecarbothioate
S-(2-sulfanylethyl) cyclohexanecarbothioate (PubChem CID 156524567) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is S-(2-sulfanylethyl) cyclohexanecarbothioate.
Molecular Properties
| Compound Name | S-(2-sulfanylethyl) cyclohexanecarbothioate |
| PubChem CID | 156524567 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | S-(2-sulfanylethyl) cyclohexanecarbothioate |
| SMILES | O=C(SCCS)C1CCCCC1 |
| InChI | InChI=1S/C9H16OS2/c10-9(12-7-6-11)8-4-2-1-3-5-8/h8,11H,1-7H2 |
| InChIKey | DWMHLLABRJMNBN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-(2-sulfanylethyl) cyclohexanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-sulfanylethyl) cyclohexanecarbothioate?
The IUPAC name of S-(2-sulfanylethyl) cyclohexanecarbothioate (CID 156524567) is S-(2-sulfanylethyl) cyclohexanecarbothioate.
What is the SMILES notation for S-(2-sulfanylethyl) cyclohexanecarbothioate?
The canonical SMILES for S-(2-sulfanylethyl) cyclohexanecarbothioate is O=C(SCCS)C1CCCCC1.
What is the InChIKey of S-(2-sulfanylethyl) cyclohexanecarbothioate?
The InChIKey is DWMHLLABRJMNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c10-9(12-7-6-11)8-4-2-1-3-5-8/h8,11H,1-7H2.
What are the key properties of S-(2-sulfanylethyl) cyclohexanecarbothioate?
S-(2-sulfanylethyl) cyclohexanecarbothioate has a molecular weight of 204.36 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-sulfanylethyl) cyclohexanecarbothioate is sourced from PubChem (CID 156524567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).