C12H20O2S2 — CID 59181102
1-S,2-S-diethyl cyclohexane-1,2-dicarbothioate (PubChem CID 59181102) has the molecular formula C12H20O2S2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-S,2-S-diethyl cyclohexane-1,2-dicarbothioate.
| Compound Name | 1-S,2-S-diethyl cyclohexane-1,2-dicarbothioate |
|---|---|
| PubChem CID | 59181102 |
| Molecular Formula | C12H20O2S2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-S,2-S-diethyl cyclohexane-1,2-dicarbothioate |
| SMILES | CCSC(=O)C1CCCCC1C(=O)SCC |
| InChI | InChI=1S/C12H20O2S2/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | BFRVGCVSEYGTJR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|