C12H24N2 — CID 123202734
1-methyl-4-(4-methylpent-2-en-3-yl)-1,4-diazepane (PubChem CID 123202734) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-methyl-4-(4-methylpent-2-en-3-yl)-1,4-diazepane.
| Compound Name | 1-methyl-4-(4-methylpent-2-en-3-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 123202734 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-methyl-4-(4-methylpent-2-en-3-yl)-1,4-diazepane |
| SMILES | CC=C(C(C)C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C12H24N2/c1-5-12(11(2)3)14-8-6-7-13(4)9-10-14/h5,11H,6-10H2,1-4H3 |
| InChIKey | NLFIYWMITGUULP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |