C12H26N2 — CID 142053759
1-but-1-en-2-yl-4-methyl-1,4-diazepane;ethane (PubChem CID 142053759) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-but-1-en-2-yl-4-methyl-1,4-diazepane;ethane.
| Compound Name | 1-but-1-en-2-yl-4-methyl-1,4-diazepane;ethane |
|---|---|
| PubChem CID | 142053759 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-but-1-en-2-yl-4-methyl-1,4-diazepane;ethane |
| SMILES | C=C(CC)N1CCCN(C)CC1.CC |
| InChI | InChI=1S/C10H20N2.C2H6/c1-4-10(2)12-7-5-6-11(3)8-9-12;1-2/h2,4-9H2,1,3H3;1-2H3 |
| InChIKey | FTULIDQRJOIXDT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |