C16H34N2 — CID 143054400
ethane;1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-methyl-1,4-diazepane;methane (PubChem CID 143054400) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-methyl-1,4-diazepane;methane.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-methyl-1,4-diazepane;methane |
|---|---|
| PubChem CID | 143054400 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-methyl-1,4-diazepane;methane |
| SMILES | C.CC.CC/C=C\C=C(/C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C13H24N2.C2H6.CH4/c1-4-5-6-8-13(2)15-10-7-9-14(3)11-12-15;1-2;/h5-6,8H,4,7,9-12H2,1-3H3;1-2H3;1H4/b6-5-,13-8+;; |
| InChIKey | NLBJAYKUGYCAKN-USTFYAQHSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|