C15H28N2 — CID 143028437
ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane (PubChem CID 143028437) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 143028437 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane |
| SMILES | C=C/C=C\C=C(/C)N1CCCN(C)CC1.CC |
| InChI | InChI=1S/C13H22N2.C2H6/c1-4-5-6-8-13(2)15-10-7-9-14(3)11-12-15;1-2/h4-6,8H,1,7,9-12H2,2-3H3;1-2H3/b6-5-,13-8+; |
| InChIKey | JLWVUMBSJJVGCF-KBMSYEABSA-N |
| XLogP | 3.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|