C11H20N2 — CID 91160948
N'-hexa-1,3,5-trien-2-yl-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 91160948) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N'-hexa-1,3,5-trien-2-yl-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-hexa-1,3,5-trien-2-yl-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 91160948 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N'-hexa-1,3,5-trien-2-yl-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=CC=CC(=C)N(C)CCN(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-7-8-11(2)13(5)10-9-12(3)4/h6-8H,1-2,9-10H2,3-5H3 |
| InChIKey | FHBJIVLKKMVRSM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|