C10H17N3 — CID 77152514
3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile (PubChem CID 77152514) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile.
| Compound Name | 3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 77152514 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-(4-methyl-1,4-diazepan-1-yl)but-2-enenitrile |
| SMILES | CC(=CC#N)N1CCCN(C)CC1 |
| InChI | InChI=1S/C10H17N3/c1-10(4-5-11)13-7-3-6-12(2)8-9-13/h4H,3,6-9H2,1-2H3 |
| InChIKey | MLEWABOKJFCPRO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|