C13H22N2 — CID 143028438
1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane (PubChem CID 143028438) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 143028438 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-methyl-1,4-diazepane |
| SMILES | C=C/C=C\C=C(/C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C13H22N2/c1-4-5-6-8-13(2)15-10-7-9-14(3)11-12-15/h4-6,8H,1,7,9-12H2,2-3H3/b6-5-,13-8+ |
| InChIKey | FFALWZMOZJNJJZ-AVHOOITRSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|