C6H8N3+ — CID 123203336
4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-ium (PubChem CID 123203336) has the molecular formula C6H8N3+ and a molecular weight of 122.15 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-ium.
| Compound Name | 4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 123203336 |
| Molecular Formula | C6H8N3+ |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-2-ium |
| SMILES | C1=[N+]=NC2=C1CNCC2 |
| InChI | InChI=1S/C6H8N3/c1-2-7-3-5-4-8-9-6(1)5/h4,7H,1-3H2/q+1 |
| InChIKey | QYKIBSHEUFGAEA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|