C6H12N3+ — CID 149247962
(4-amino-1,2,3,6-tetrahydropyridin-5-yl)methylideneazanium (PubChem CID 149247962) has the molecular formula C6H12N3+ and a molecular weight of 126.18 g/mol. Its IUPAC name is (4-amino-1,2,3,6-tetrahydropyridin-5-yl)methylideneazanium.
| Compound Name | (4-amino-1,2,3,6-tetrahydropyridin-5-yl)methylideneazanium |
|---|---|
| PubChem CID | 149247962 |
| Molecular Formula | C6H12N3+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (4-amino-1,2,3,6-tetrahydropyridin-5-yl)methylideneazanium |
| SMILES | NC1=C(C=[NH2+])CNCC1 |
| InChI | InChI=1S/C6H11N3/c7-3-5-4-9-2-1-6(5)8/h3,7,9H,1-2,4,8H2/p+1 |
| InChIKey | XNMBFQSEUYSSFU-UHFFFAOYSA-O |
| XLogP | -1.98 |
| TPSA | 63.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|