C7H12N2 — CID 91200283
(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine (PubChem CID 91200283) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine.
| Compound Name | (4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
|---|---|
| PubChem CID | 91200283 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
| SMILES | [H]/N=C/C1=C(C)CCNC1 |
| InChI | InChI=1S/C7H12N2/c1-6-2-3-9-5-7(6)4-8/h4,8-9H,2-3,5H2,1H3/b8-4+ |
| InChIKey | MEWTWTXQFXXTSC-XBXARRHUSA-N |
| XLogP | 0.95 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|