C7H12N+ — CID 134851930
4,5-dimethyl-2,3-dihydropyridin-1-ium (PubChem CID 134851930) has the molecular formula C7H12N+ and a molecular weight of 110.18 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydropyridin-1-ium.
| Compound Name | 4,5-dimethyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 134851930 |
| Molecular Formula | C7H12N+ |
| Molecular Weight | 110.18 g/mol |
| Exact Mass | 110.10 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydropyridin-1-ium |
| SMILES | CC1=C(C)CC[NH+]=C1 |
| InChI | InChI=1S/C7H11N/c1-6-3-4-8-5-7(6)2/h5H,3-4H2,1-2H3/p+1 |
| InChIKey | HLOOEECNZPXDQG-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |