C8H14N2 — CID 142384169
N-methyl-1-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine (PubChem CID 142384169) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine.
| Compound Name | N-methyl-1-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
|---|---|
| PubChem CID | 142384169 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-methyl-1-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
| SMILES | C/N=C/C1=C(C)CCNC1 |
| InChI | InChI=1S/C8H14N2/c1-7-3-4-10-6-8(7)5-9-2/h5,10H,3-4,6H2,1-2H3/b9-5+ |
| InChIKey | QHOANBIVJSPZNZ-WEVVVXLNSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|