C7H13N3 — CID 123963812
(5-methanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)methanamine (PubChem CID 123963812) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (5-methanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)methanamine.
| Compound Name | (5-methanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 123963812 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (5-methanimidoyl-1,2,3,6-tetrahydropyridin-4-yl)methanamine |
| SMILES | [H]/N=C/C1=C(CN)CCNC1 |
| InChI | InChI=1S/C7H13N3/c8-3-6-1-2-10-5-7(6)4-9/h4,9-10H,1-3,5,8H2/b9-4+ |
| InChIKey | VPPWNGCFLBTNBZ-RUDMXATFSA-N |
| XLogP | -0.12 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|