About (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid
(2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid (PubChem CID 123203428) has the molecular formula C16H12I4O3
and a molecular weight of 759.88 g/mol. Its IUPAC name is (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid |
| PubChem CID | 123203428 |
| Molecular Formula | C16H12I4O3 |
| Molecular Weight | 759.88 g/mol |
| Exact Mass | 759.70 |
| IUPAC Name | (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid |
| SMILES | C[C@@H](Cc1cc(I)c(Oc2cc(I)cc(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C16H12I4O3/c1-8(16(21)22)2-9-3-13(19)15(14(20)4-9)23-12-6-10(17)5-11(18)7-12/h3-8H,2H2,1H3,(H,21,22)/t8-/m0/s1 |
| InChIKey | FSRLVUYUSLDNRQ-QMMMGPOBSA-N |
| XLogP | 6.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 759.88 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid?
The IUPAC name of (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid (CID 123203428) is (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid.
What is the SMILES notation for (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid?
The canonical SMILES for (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid is C[C@@H](Cc1cc(I)c(Oc2cc(I)cc(I)c2)c(I)c1)C(=O)O.
What is the InChIKey of (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid?
The InChIKey is FSRLVUYUSLDNRQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C16H12I4O3/c1-8(16(21)22)2-9-3-13(19)15(14(20)4-9)23-12-6-10(17)5-11(18)7-12/h3-8H,2H2,1H3,(H,21,22)/t8-/m0/s1.
What are the key properties of (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid?
(2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid has a molecular weight of 759.88 g/mol, XLogP of 6.16, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-[4-(3,5-diiodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid is sourced from PubChem (CID 123203428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).