C15H21NOS — CID 123203534
(2Z,4Z)-2-(4-methyl-3,4,5,6-tetrahydroazepin-2-ylidene)-4-propylideneoxane-3-thione (PubChem CID 123203534) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (2Z,4Z)-2-(4-methyl-3,4,5,6-tetrahydroazepin-2-ylidene)-4-propylideneoxane-3-thione.
| Compound Name | (2Z,4Z)-2-(4-methyl-3,4,5,6-tetrahydroazepin-2-ylidene)-4-propylideneoxane-3-thione |
|---|---|
| PubChem CID | 123203534 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2Z,4Z)-2-(4-methyl-3,4,5,6-tetrahydroazepin-2-ylidene)-4-propylideneoxane-3-thione |
| SMILES | CC/C=C1/CCO/C(=C2/CC(C)CCC=N2)C1=S |
| InChI | InChI=1S/C15H21NOS/c1-3-5-12-7-9-17-14(15(12)18)13-10-11(2)6-4-8-16-13/h5,8,11H,3-4,6-7,9-10H2,1-2H3/b12-5-,14-13- |
| InChIKey | XKQRHJCXSSLAOM-FLNLLXCPSA-N |
| XLogP | 4.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|