C14H30O3P+ — CID 123205024
tert-butyl-[1-(2,4-dimethylpentan-2-yloxy)propan-2-yloxy]-oxophosphanium (PubChem CID 123205024) has the molecular formula C14H30O3P+ and a molecular weight of 277.37 g/mol. Its IUPAC name is tert-butyl-[1-(2,4-dimethylpentan-2-yloxy)propan-2-yloxy]-oxophosphanium.
| Compound Name | tert-butyl-[1-(2,4-dimethylpentan-2-yloxy)propan-2-yloxy]-oxophosphanium |
|---|---|
| PubChem CID | 123205024 |
| Molecular Formula | C14H30O3P+ |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | tert-butyl-[1-(2,4-dimethylpentan-2-yloxy)propan-2-yloxy]-oxophosphanium |
| SMILES | CC(C)CC(C)(C)OCC(C)O[P+](=O)C(C)(C)C |
| InChI | InChI=1S/C14H30O3P/c1-11(2)9-14(7,8)16-10-12(3)17-18(15)13(4,5)6/h11-12H,9-10H2,1-8H3/q+1 |
| InChIKey | QCUHWWUSBWCJBF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|