C24H27ClN6 — CID 123206456
4-N-(4-chlorophenyl)-6-N-(3-methylhepta-2,4-dienyl)-2-N-(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 123206456) has the molecular formula C24H27ClN6 and a molecular weight of 434.98 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-N-(3-methylhepta-2,4-dienyl)-2-N-(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-N-(3-methylhepta-2,4-dienyl)-2-N-(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 123206456 |
| Molecular Formula | C24H27ClN6 |
| Molecular Weight | 434.98 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-N-(3-methylhepta-2,4-dienyl)-2-N-(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCC=CC(C)=CCNc1nc(Nc2ccc(Cl)cc2)nc(Nc2cccc(C)c2)n1 |
| InChI | InChI=1S/C24H27ClN6/c1-4-5-7-17(2)14-15-26-22-29-23(27-20-12-10-19(25)11-13-20)31-24(30-22)28-21-9-6-8-18(3)16-21/h5-14,16H,4,15H2,1-3H3,(H3,26,27,28,29,30,31) |
| InChIKey | WVRLQEPZGODPGM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.98 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|