C26H47N7O9 — CID 123208042
3-[2-[2-[[2-[[6-amino-2-[3-(methylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]pentanoylamino]-2-oxobutanoic acid (PubChem CID 123208042) has the molecular formula C26H47N7O9 and a molecular weight of 601.70 g/mol. Its IUPAC name is 3-[2-[2-[[2-[[6-amino-2-[3-(methylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]pentanoylamino]-2-oxobutanoic acid.
| Compound Name | 3-[2-[2-[[2-[[6-amino-2-[3-(methylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]pentanoylamino]-2-oxobutanoic acid |
|---|---|
| PubChem CID | 123208042 |
| Molecular Formula | C26H47N7O9 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.34 |
| IUPAC Name | 3-[2-[2-[[2-[[6-amino-2-[3-(methylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]pentanoylamino]-2-oxobutanoic acid |
| SMILES | CCCC(NC(=O)C(C)NC(=O)C(NC(=O)C(CCCCN)NC(=O)CCNC)C(C)O)C(=O)NC(C)C(=O)C(=O)O |
| InChI | InChI=1S/C26H47N7O9/c1-6-9-17(23(38)29-14(2)21(36)26(41)42)32-22(37)15(3)30-25(40)20(16(4)34)33-24(39)18(10-7-8-12-27)31-19(35)11-13-28-5/h14-18,20,28,34H,6-13,27H2,1-5H3,(H,29,38)(H,30,40)(H,31,35)(H,32,37)(H,33,39)(H,41,42) |
| InChIKey | GGPHAPGQZVATML-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 258.15 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|