C10H6F6O3S — CID 123208697
2-[5,5,5-trifluoro-4-(trifluoromethylsulfonyl)penta-1,3-dienyl]furan (PubChem CID 123208697) has the molecular formula C10H6F6O3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 2-[5,5,5-trifluoro-4-(trifluoromethylsulfonyl)penta-1,3-dienyl]furan.
| Compound Name | 2-[5,5,5-trifluoro-4-(trifluoromethylsulfonyl)penta-1,3-dienyl]furan |
|---|---|
| PubChem CID | 123208697 |
| Molecular Formula | C10H6F6O3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-[5,5,5-trifluoro-4-(trifluoromethylsulfonyl)penta-1,3-dienyl]furan |
| SMILES | O=S(=O)(C(=CC=Cc1ccco1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F6O3S/c11-9(12,13)8(20(17,18)10(14,15)16)5-1-3-7-4-2-6-19-7/h1-6H |
| InChIKey | YHZJDZRQRSUCRL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|