C16H13BrO2 — CID 4018511
1-(4-bromophenyl)-5-(furan-2-yl)-2-methylpenta-2,4-dien-1-one (PubChem CID 4018511) has the molecular formula C16H13BrO2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-(furan-2-yl)-2-methylpenta-2,4-dien-1-one.
| Compound Name | 1-(4-bromophenyl)-5-(furan-2-yl)-2-methylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 4018511 |
| Molecular Formula | C16H13BrO2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-(4-bromophenyl)-5-(furan-2-yl)-2-methylpenta-2,4-dien-1-one |
| SMILES | CC(=CC=Cc1ccco1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrO2/c1-12(4-2-5-15-6-3-11-19-15)16(18)13-7-9-14(17)10-8-13/h2-11H,1H3 |
| InChIKey | OUHKVDMMOQRVOS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|