C13H22N2O5 — CID 123208761
2,5-dihydroxy-3-methyl-N-[2-(2-propoxyethoxy)ethyl]pyrrole-1-carboxamide (PubChem CID 123208761) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2,5-dihydroxy-3-methyl-N-[2-(2-propoxyethoxy)ethyl]pyrrole-1-carboxamide.
| Compound Name | 2,5-dihydroxy-3-methyl-N-[2-(2-propoxyethoxy)ethyl]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 123208761 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,5-dihydroxy-3-methyl-N-[2-(2-propoxyethoxy)ethyl]pyrrole-1-carboxamide |
| SMILES | CCCOCCOCCNC(=O)n1c(O)cc(C)c1O |
| InChI | InChI=1S/C13H22N2O5/c1-3-5-19-7-8-20-6-4-14-13(18)15-11(16)9-10(2)12(15)17/h9,16-17H,3-8H2,1-2H3,(H,14,18) |
| InChIKey | HOJJEMUGLVJKGB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|