About methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate
methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate (PubChem CID 91452715) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate.
Analyze methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The IUPAC name of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate (CID 91452715) is methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate is COC(=O)NCCn1c(O)cc(C)c1O.
What is the InChIKey of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The InChIKey is XQVRPWTYYAGWMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-6-5-7(12)11(8(6)13)4-3-10-9(14)15-2/h5,12-13H,3-4H2,1-2H3,(H,10,14).
What are the key properties of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate has a molecular weight of 214.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate is sourced from PubChem (CID 91452715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).