methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate

C9H14N2O4 — CID 91452715

IUPACmethyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate
SMILESCOC(=O)NCCn1c(O)cc(C)c1O
InChIInChI=1S/C9H14N2O4/c1-6-5-7(12)11(8(6)13)4-3-10-9(14)15-2/h5,12-13H,3-4H2,1-2H3,(H,10,14)
InChIKeyXQVRPWTYYAGWMR-UHFFFAOYSA-N
MW214.22 g/mol
LogP0.56
Rot. Bonds3

About methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate

methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate (PubChem CID 91452715) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate.

Molecular Properties

Compound Namemethyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate
PubChem CID91452715
Molecular FormulaC9H14N2O4
Molecular Weight214.22 g/mol
Exact Mass214.10
IUPAC Namemethyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate
SMILESCOC(=O)NCCn1c(O)cc(C)c1O
InChIInChI=1S/C9H14N2O4/c1-6-5-7(12)11(8(6)13)4-3-10-9(14)15-2/h5,12-13H,3-4H2,1-2H3,(H,10,14)
InChIKeyXQVRPWTYYAGWMR-UHFFFAOYSA-N
XLogP0.56
TPSA83.72 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.22
LogP ≤ 50.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The IUPAC name of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate (CID 91452715) is methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate is COC(=O)NCCn1c(O)cc(C)c1O.
What is the InChIKey of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
The InChIKey is XQVRPWTYYAGWMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-6-5-7(12)11(8(6)13)4-3-10-9(14)15-2/h5,12-13H,3-4H2,1-2H3,(H,10,14).
What are the key properties of methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate?
methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate has a molecular weight of 214.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl]carbamate is sourced from PubChem (CID 91452715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).