C11H18N2O3 — CID 90740310
3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-propylpropanamide (PubChem CID 90740310) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-propylpropanamide.
| Compound Name | 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-propylpropanamide |
|---|---|
| PubChem CID | 90740310 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-propylpropanamide |
| SMILES | CCCNC(=O)CCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C11H18N2O3/c1-3-5-12-9(14)4-6-13-10(15)7-8(2)11(13)16/h7,15-16H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | IQAJHEODYBUKAX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |