C8H10N2O3 — CID 54111603
3-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one (PubChem CID 54111603) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 54111603 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)pyrrolidin-2-one |
| SMILES | O=C1NCCC1n1c(O)ccc1O |
| InChI | InChI=1S/C8H10N2O3/c11-6-1-2-7(12)10(6)5-3-4-9-8(5)13/h1-2,5,11-12H,3-4H2,(H,9,13) |
| InChIKey | PLNDOVUBXUKVHQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |