C10H16N2O3 — CID 54034188
6-(2,5-dihydroxypyrrol-1-yl)hexanamide (PubChem CID 54034188) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-(2,5-dihydroxypyrrol-1-yl)hexanamide.
| Compound Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 54034188 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 6-(2,5-dihydroxypyrrol-1-yl)hexanamide |
| SMILES | NC(=O)CCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C10H16N2O3/c11-8(13)4-2-1-3-7-12-9(14)5-6-10(12)15/h5-6,14-15H,1-4,7H2,(H2,11,13) |
| InChIKey | LHSYGLVQNRPVFH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|