C15H24N2O7 — CID 123443469
3-[2-[2-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid (PubChem CID 123443469) has the molecular formula C15H24N2O7 and a molecular weight of 344.36 g/mol. Its IUPAC name is 3-[2-[2-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 123443469 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[2-[2-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoic acid |
| SMILES | Cc1cc(O)n(CCC(=O)NCCOCCOCCC(=O)O)c1O |
| InChI | InChI=1S/C15H24N2O7/c1-11-10-13(19)17(15(11)22)5-2-12(18)16-4-7-24-9-8-23-6-3-14(20)21/h10,19,22H,2-9H2,1H3,(H,16,18)(H,20,21) |
| InChIKey | IUJWRGFMVGNDNR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|