C22H31N3O11 — CID 90685216
(2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 90685216) has the molecular formula C22H31N3O11 and a molecular weight of 513.50 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 90685216 |
| Molecular Formula | C22H31N3O11 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C22H31N3O11/c26-17(5-8-24-18(27)1-2-19(24)28)23-7-10-33-12-14-35-16-15-34-13-11-32-9-6-22(31)36-25-20(29)3-4-21(25)30/h1-4,29-30H,5-16H2,(H,23,26) |
| InChIKey | JPEIZZPKTSIQIA-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 175.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|