C22H32N3O12+ — CID 88933104
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 88933104) has the molecular formula C22H32N3O12+ and a molecular weight of 530.51 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 88933104 |
| Molecular Formula | C22H32N3O12+ |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCC(=O)O[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C22H31N3O12/c26-17(5-8-24-18(27)1-2-19(24)28)23-7-10-34-12-14-36-16-15-35-13-11-33-9-6-22(31)37-25(32)20(29)3-4-21(25)30/h1-2,32H,3-16H2/p+1 |
| InChIKey | ZJUXIOIMLBUFPC-UHFFFAOYSA-O |
| XLogP | -1.61 |
| TPSA | 184.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|