C10H16N2O3 — CID 91091349
4-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylbutanamide (PubChem CID 91091349) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylbutanamide.
| Compound Name | 4-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 91091349 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C10H16N2O3/c1-7-6-9(14)12(10(7)15)5-3-4-8(13)11-2/h6,14-15H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | XIMXEMBBJCZHMV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |