C15H20N2O7 — CID 90866294
(2,5-dihydroxypyrrol-1-yl) 3-[2-[2-(but-3-ynoylamino)ethoxy]ethoxy]propanoate (PubChem CID 90866294) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-(but-3-ynoylamino)ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-(but-3-ynoylamino)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 90866294 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-(but-3-ynoylamino)ethoxy]ethoxy]propanoate |
| SMILES | C#CCC(=O)NCCOCCOCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H20N2O7/c1-2-3-12(18)16-7-9-23-11-10-22-8-6-15(21)24-17-13(19)4-5-14(17)20/h1,4-5,19-20H,3,6-11H2,(H,16,18) |
| InChIKey | VCQDIAMUVHYFFT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|