C11H21N3 — CID 123209322
N'-ethyl-N'-(2-imino-5-methylhexa-3,5-dienyl)ethane-1,2-diamine (PubChem CID 123209322) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N'-ethyl-N'-(2-imino-5-methylhexa-3,5-dienyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(2-imino-5-methylhexa-3,5-dienyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123209322 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N'-ethyl-N'-(2-imino-5-methylhexa-3,5-dienyl)ethane-1,2-diamine |
| SMILES | [H]/N=C(\C=CC(=C)C)CN(CC)CCN |
| InChI | InChI=1S/C11H21N3/c1-4-14(8-7-12)9-11(13)6-5-10(2)3/h5-6,13H,2,4,7-9,12H2,1,3H3/b6-5?,13-11+ |
| InChIKey | JZTAZPOUGGNHQJ-PLYMDNEQSA-N |
| XLogP | 1.42 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|